C22H38N2 — CID 177018977
(3Z,5Z,6Z)-6-(cyclohexylmethyl)-5-[1-(ethylideneamino)ethylidene]-3-methyldeca-3,6-dien-4-amine (PubChem CID 177018977) has the molecular formula C22H38N2 and a molecular weight of 330.56 g/mol. Its IUPAC name is (3Z,5Z,6Z)-6-(cyclohexylmethyl)-5-[1-(ethylideneamino)ethylidene]-3-methyldeca-3,6-dien-4-amine.
| Compound Name | (3Z,5Z,6Z)-6-(cyclohexylmethyl)-5-[1-(ethylideneamino)ethylidene]-3-methyldeca-3,6-dien-4-amine |
|---|---|
| PubChem CID | 177018977 |
| Molecular Formula | C22H38N2 |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.30 |
| IUPAC Name | (3Z,5Z,6Z)-6-(cyclohexylmethyl)-5-[1-(ethylideneamino)ethylidene]-3-methyldeca-3,6-dien-4-amine |
| SMILES | C/C=N/C(C)=C(C(=C\CCC)/CC1CCCCC1)\C(N)=C(/C)CC |
| InChI | InChI=1S/C22H38N2/c1-6-9-15-20(16-19-13-11-10-12-14-19)21(18(5)24-8-3)22(23)17(4)7-2/h8,15,19H,6-7,9-14,16,23H2,1-5H3/b20-15-,21-18-,22-17-,24-8+ |
| InChIKey | HIRIXBOGVLGFJT-AXXSRHGZSA-N |
| XLogP | 6.69 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|