C31H59N — CID 143983035
ethane;N-[(7E,11E,13Z)-11-ethyl-13-ethylidene-8-methyl-16-propylnonadeca-7,11-dien-7-yl]ethanimine (PubChem CID 143983035) has the molecular formula C31H59N and a molecular weight of 445.82 g/mol. Its IUPAC name is ethane;N-[(7E,11E,13Z)-11-ethyl-13-ethylidene-8-methyl-16-propylnonadeca-7,11-dien-7-yl]ethanimine.
| Compound Name | ethane;N-[(7E,11E,13Z)-11-ethyl-13-ethylidene-8-methyl-16-propylnonadeca-7,11-dien-7-yl]ethanimine |
|---|---|
| PubChem CID | 143983035 |
| Molecular Formula | C31H59N |
| Molecular Weight | 445.82 g/mol |
| Exact Mass | 445.46 |
| IUPAC Name | ethane;N-[(7E,11E,13Z)-11-ethyl-13-ethylidene-8-methyl-16-propylnonadeca-7,11-dien-7-yl]ethanimine |
| SMILES | C/C=C(\C=C(/CC)CC/C(C)=C(CCCCCC)/N=C/C)CCC(CCC)CCC.CC |
| InChI | InChI=1S/C29H53N.C2H6/c1-8-14-15-16-19-29(30-13-6)25(7)20-21-26(11-4)24-27(12-5)22-23-28(17-9-2)18-10-3;1-2/h12-13,24,28H,8-11,14-23H2,1-7H3;1-2H3/b26-24+,27-12-,29-25+,30-13+; |
| InChIKey | ZUMQRCQSISYMNJ-HRYFHMMYSA-N |
| XLogP | 11.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.82 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|