C18H33N — CID 123238353
5-(6-methylheptyl)-7-(2-methylpropyl)-4,5-dihydro-3H-azepine (PubChem CID 123238353) has the molecular formula C18H33N and a molecular weight of 263.47 g/mol. Its IUPAC name is 5-(6-methylheptyl)-7-(2-methylpropyl)-4,5-dihydro-3H-azepine.
| Compound Name | 5-(6-methylheptyl)-7-(2-methylpropyl)-4,5-dihydro-3H-azepine |
|---|---|
| PubChem CID | 123238353 |
| Molecular Formula | C18H33N |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.26 |
| IUPAC Name | 5-(6-methylheptyl)-7-(2-methylpropyl)-4,5-dihydro-3H-azepine |
| SMILES | CC(C)CCCCCC1C=C(CC(C)C)N=CCC1 |
| InChI | InChI=1S/C18H33N/c1-15(2)9-6-5-7-10-17-11-8-12-19-18(14-17)13-16(3)4/h12,14-17H,5-11,13H2,1-4H3 |
| InChIKey | AGCJHHIXRKUSOH-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|