C19H35N — CID 123493449
N-(9-ethyl-3,6-dimethyltrideca-3,5-dien-2-yl)ethanimine (PubChem CID 123493449) has the molecular formula C19H35N and a molecular weight of 277.50 g/mol. Its IUPAC name is N-(9-ethyl-3,6-dimethyltrideca-3,5-dien-2-yl)ethanimine.
| Compound Name | N-(9-ethyl-3,6-dimethyltrideca-3,5-dien-2-yl)ethanimine |
|---|---|
| PubChem CID | 123493449 |
| Molecular Formula | C19H35N |
| Molecular Weight | 277.50 g/mol |
| Exact Mass | 277.28 |
| IUPAC Name | N-(9-ethyl-3,6-dimethyltrideca-3,5-dien-2-yl)ethanimine |
| SMILES | C/C=N/C(C)C(C)=CC=C(C)CCC(CC)CCCC |
| InChI | InChI=1S/C19H35N/c1-7-10-11-19(8-2)15-13-16(4)12-14-17(5)18(6)20-9-3/h9,12,14,18-19H,7-8,10-11,13,15H2,1-6H3/b16-12?,17-14?,20-9+ |
| InChIKey | HJHJXQBPQZMMSP-IPGRIWOXSA-N |
| XLogP | 6.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.50 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|