C19H38 — CID 123664205
9-ethyl-5-ethylidene-2,4-dimethyltridecane (PubChem CID 123664205) has the molecular formula C19H38 and a molecular weight of 266.51 g/mol. Its IUPAC name is 9-ethyl-5-ethylidene-2,4-dimethyltridecane.
| Compound Name | 9-ethyl-5-ethylidene-2,4-dimethyltridecane |
|---|---|
| PubChem CID | 123664205 |
| Molecular Formula | C19H38 |
| Molecular Weight | 266.51 g/mol |
| Exact Mass | 266.30 |
| IUPAC Name | 9-ethyl-5-ethylidene-2,4-dimethyltridecane |
| SMILES | CC=C(CCCC(CC)CCCC)C(C)CC(C)C |
| InChI | InChI=1S/C19H38/c1-7-10-12-18(8-2)13-11-14-19(9-3)17(6)15-16(4)5/h9,16-18H,7-8,10-15H2,1-6H3 |
| InChIKey | FPVPYWVSODJFPN-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.51 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|