C24H44O4 — CID 87527831
5-ethyl-2-methylidenenonanoic acid;9-methyl-2-methylidenedecanoic acid (PubChem CID 87527831) has the molecular formula C24H44O4 and a molecular weight of 396.61 g/mol. Its IUPAC name is 5-ethyl-2-methylidenenonanoic acid;9-methyl-2-methylidenedecanoic acid.
| Compound Name | 5-ethyl-2-methylidenenonanoic acid;9-methyl-2-methylidenedecanoic acid |
|---|---|
| PubChem CID | 87527831 |
| Molecular Formula | C24H44O4 |
| Molecular Weight | 396.61 g/mol |
| Exact Mass | 396.32 |
| IUPAC Name | 5-ethyl-2-methylidenenonanoic acid;9-methyl-2-methylidenedecanoic acid |
| SMILES | C=C(CCC(CC)CCCC)C(=O)O.C=C(CCCCCCC(C)C)C(=O)O |
| InChI | InChI=1S/2C12H22O2/c1-10(2)8-6-4-5-7-9-11(3)12(13)14;1-4-6-7-11(5-2)9-8-10(3)12(13)14/h10H,3-9H2,1-2H3,(H,13,14);11H,3-9H2,1-2H3,(H,13,14) |
| InChIKey | UXWOKKMEYBZIFT-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.61 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|