C17H26N2 — CID 143323372
ethane;1-(ethylideneamino)-7-methylidene-3-[(Z)-prop-1-enyl]-3a,4,5,6-tetrahydroinden-2-amine (PubChem CID 143323372) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is ethane;1-(ethylideneamino)-7-methylidene-3-[(Z)-prop-1-enyl]-3a,4,5,6-tetrahydroinden-2-amine.
| Compound Name | ethane;1-(ethylideneamino)-7-methylidene-3-[(Z)-prop-1-enyl]-3a,4,5,6-tetrahydroinden-2-amine |
|---|---|
| PubChem CID | 143323372 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | ethane;1-(ethylideneamino)-7-methylidene-3-[(Z)-prop-1-enyl]-3a,4,5,6-tetrahydroinden-2-amine |
| SMILES | C=C1CCCC2C(/C=C\C)=C(N)C(/N=C/C)=C12.CC |
| InChI | InChI=1S/C15H20N2.C2H6/c1-4-7-12-11-9-6-8-10(3)13(11)15(14(12)16)17-5-2;1-2/h4-5,7,11H,3,6,8-9,16H2,1-2H3;1-2H3/b7-4-,17-5+; |
| InChIKey | QHYYCZNYVZEZSF-SZHPHOQDSA-N |
| XLogP | 4.52 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|