C19H34N2 — CID 143767816
ethane;4-ethyl-3-(ethylideneamino)-2-[(2Z)-penta-2,4-dien-2-yl]cyclohexa-1,3-dien-1-amine (PubChem CID 143767816) has the molecular formula C19H34N2 and a molecular weight of 290.50 g/mol. Its IUPAC name is ethane;4-ethyl-3-(ethylideneamino)-2-[(2Z)-penta-2,4-dien-2-yl]cyclohexa-1,3-dien-1-amine.
| Compound Name | ethane;4-ethyl-3-(ethylideneamino)-2-[(2Z)-penta-2,4-dien-2-yl]cyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 143767816 |
| Molecular Formula | C19H34N2 |
| Molecular Weight | 290.50 g/mol |
| Exact Mass | 290.27 |
| IUPAC Name | ethane;4-ethyl-3-(ethylideneamino)-2-[(2Z)-penta-2,4-dien-2-yl]cyclohexa-1,3-dien-1-amine |
| SMILES | C=C/C=C(/C)C1=C(N)CCC(CC)=C1/N=C/C.CC.CC |
| InChI | InChI=1S/C15H22N2.2C2H6/c1-5-8-11(4)14-13(16)10-9-12(6-2)15(14)17-7-3;2*1-2/h5,7-8H,1,6,9-10,16H2,2-4H3;2*1-2H3/b11-8-,17-7+;; |
| InChIKey | HZIKTBUCUQQLFE-YGFOSOSRSA-N |
| XLogP | 5.93 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.50 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|