C27H39N — CID 134299442
N-[(3Z,7Z,9Z)-5-methylidene-7-(2-methylprop-1-enyl)-4-[(E)-2-[(Z)-prop-1-enyl]hex-1-enyl]undeca-1,3,7,9-tetraen-3-yl]ethanimine (PubChem CID 134299442) has the molecular formula C27H39N and a molecular weight of 377.62 g/mol. Its IUPAC name is N-[(3Z,7Z,9Z)-5-methylidene-7-(2-methylprop-1-enyl)-4-[(E)-2-[(Z)-prop-1-enyl]hex-1-enyl]undeca-1,3,7,9-tetraen-3-yl]ethanimine.
| Compound Name | N-[(3Z,7Z,9Z)-5-methylidene-7-(2-methylprop-1-enyl)-4-[(E)-2-[(Z)-prop-1-enyl]hex-1-enyl]undeca-1,3,7,9-tetraen-3-yl]ethanimine |
|---|---|
| PubChem CID | 134299442 |
| Molecular Formula | C27H39N |
| Molecular Weight | 377.62 g/mol |
| Exact Mass | 377.31 |
| IUPAC Name | N-[(3Z,7Z,9Z)-5-methylidene-7-(2-methylprop-1-enyl)-4-[(E)-2-[(Z)-prop-1-enyl]hex-1-enyl]undeca-1,3,7,9-tetraen-3-yl]ethanimine |
| SMILES | C=CC(/N=C/C)=C(\C=C(\C=C/C)CCCC)C(=C)C/C(C=C(C)C)=C/C=C\C |
| InChI | InChI=1S/C27H39N/c1-9-14-17-24(16-11-3)21-26(27(12-4)28-13-5)23(8)20-25(18-15-10-2)19-22(6)7/h10-13,15-16,18-19,21H,4,8-9,14,17,20H2,1-3,5-7H3/b15-10-,16-11-,24-21-,25-18+,27-26-,28-13+ |
| InChIKey | DSRAVBHSMCKPFR-UFQVKKLJSA-N |
| XLogP | 8.62 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.62 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|