C13H15N — CID 57325378
8-cyclohex-2-en-1-ylidene-3H-azocine (PubChem CID 57325378) has the molecular formula C13H15N and a molecular weight of 185.27 g/mol. Its IUPAC name is 8-cyclohex-2-en-1-ylidene-3H-azocine.
| Compound Name | 8-cyclohex-2-en-1-ylidene-3H-azocine |
|---|---|
| PubChem CID | 57325378 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 8-cyclohex-2-en-1-ylidene-3H-azocine |
| SMILES | C1=CC/C=N\C(=C2C=CCCC2)C=C1 |
| InChI | InChI=1S/C13H15N/c1-2-7-11-14-13(10-6-1)12-8-4-3-5-9-12/h1-2,4,6,8,10-11H,3,5,7,9H2/b2-1?,10-6?,13-12?,14-11- |
| InChIKey | FPDWQDZGNRNBTA-QAYJBCPXSA-N |
| XLogP | 3.57 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |