C17H22F3N — CID 143149812
N-[(Z)-1-(5-butylcyclohepta-1,4,6-trien-1-yl)prop-1-enyl]-3,3,3-trifluoropropan-1-imine (PubChem CID 143149812) has the molecular formula C17H22F3N and a molecular weight of 297.36 g/mol. Its IUPAC name is N-[(Z)-1-(5-butylcyclohepta-1,4,6-trien-1-yl)prop-1-enyl]-3,3,3-trifluoropropan-1-imine.
| Compound Name | N-[(Z)-1-(5-butylcyclohepta-1,4,6-trien-1-yl)prop-1-enyl]-3,3,3-trifluoropropan-1-imine |
|---|---|
| PubChem CID | 143149812 |
| Molecular Formula | C17H22F3N |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N-[(Z)-1-(5-butylcyclohepta-1,4,6-trien-1-yl)prop-1-enyl]-3,3,3-trifluoropropan-1-imine |
| SMILES | C/C=C(\N=C\CC(F)(F)F)C1=CCC=C(CCCC)C=C1 |
| InChI | InChI=1S/C17H22F3N/c1-3-5-7-14-8-6-9-15(11-10-14)16(4-2)21-13-12-17(18,19)20/h4,8-11,13H,3,5-7,12H2,1-2H3/b16-4-,21-13+ |
| InChIKey | HWKLNZKSQYEPFB-BKMGXLNKSA-N |
| XLogP | 5.92 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|