C14H22F3N — CID 145096533
(2Z)-2-ethylidene-N-[(E)-1,1,1-trifluorohex-2-en-2-yl]hexan-1-imine (PubChem CID 145096533) has the molecular formula C14H22F3N and a molecular weight of 261.33 g/mol. Its IUPAC name is (2Z)-2-ethylidene-N-[(E)-1,1,1-trifluorohex-2-en-2-yl]hexan-1-imine.
| Compound Name | (2Z)-2-ethylidene-N-[(E)-1,1,1-trifluorohex-2-en-2-yl]hexan-1-imine |
|---|---|
| PubChem CID | 145096533 |
| Molecular Formula | C14H22F3N |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (2Z)-2-ethylidene-N-[(E)-1,1,1-trifluorohex-2-en-2-yl]hexan-1-imine |
| SMILES | C/C=C(\C=N\C(=C\CCC)C(F)(F)F)CCCC |
| InChI | InChI=1S/C14H22F3N/c1-4-7-9-12(6-3)11-18-13(10-8-5-2)14(15,16)17/h6,10-11H,4-5,7-9H2,1-3H3/b12-6-,13-10+,18-11+ |
| InChIKey | QRFIRYGMRUQDJK-BJOUVTQPSA-N |
| XLogP | 5.44 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|