C13H20F3N — CID 139297390
(Z)-2-propan-2-yl-N-(3,3,3-trifluoroprop-1-en-2-yl)hept-2-en-1-imine (PubChem CID 139297390) has the molecular formula C13H20F3N and a molecular weight of 247.30 g/mol. Its IUPAC name is (Z)-2-propan-2-yl-N-(3,3,3-trifluoroprop-1-en-2-yl)hept-2-en-1-imine.
| Compound Name | (Z)-2-propan-2-yl-N-(3,3,3-trifluoroprop-1-en-2-yl)hept-2-en-1-imine |
|---|---|
| PubChem CID | 139297390 |
| Molecular Formula | C13H20F3N |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | (Z)-2-propan-2-yl-N-(3,3,3-trifluoroprop-1-en-2-yl)hept-2-en-1-imine |
| SMILES | C=C(/N=C/C(=C\CCCC)C(C)C)C(F)(F)F |
| InChI | InChI=1S/C13H20F3N/c1-5-6-7-8-12(10(2)3)9-17-11(4)13(14,15)16/h8-10H,4-7H2,1-3H3/b12-8+,17-9+ |
| InChIKey | FGYQDFDDUFMZRD-MAJDQBKLSA-N |
| XLogP | 4.91 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|