C10H12BrF3O — CID 10934991
(3E,5Z)-5-bromo-1,1,1-trifluorodeca-3,5-dien-2-one (PubChem CID 10934991) has the molecular formula C10H12BrF3O and a molecular weight of 285.10 g/mol. Its IUPAC name is (3E,5Z)-5-bromo-1,1,1-trifluorodeca-3,5-dien-2-one.
| Compound Name | (3E,5Z)-5-bromo-1,1,1-trifluorodeca-3,5-dien-2-one |
|---|---|
| PubChem CID | 10934991 |
| Molecular Formula | C10H12BrF3O |
| Molecular Weight | 285.10 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | (3E,5Z)-5-bromo-1,1,1-trifluorodeca-3,5-dien-2-one |
| SMILES | CCCC/C=C(Br)/C=C/C(=O)C(F)(F)F |
| InChI | InChI=1S/C10H12BrF3O/c1-2-3-4-5-8(11)6-7-9(15)10(12,13)14/h5-7H,2-4H2,1H3/b7-6+,8-5- |
| InChIKey | ALOQDRNPTZEGOJ-NGWHPUCNSA-N |
| XLogP | 4.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.10 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|