C11H15F3 — CID 10888998
(3E,5E)-2-(trifluoromethyl)deca-1,3,5-triene (PubChem CID 10888998) has the molecular formula C11H15F3 and a molecular weight of 204.23 g/mol. Its IUPAC name is (3E,5E)-2-(trifluoromethyl)deca-1,3,5-triene.
| Compound Name | (3E,5E)-2-(trifluoromethyl)deca-1,3,5-triene |
|---|---|
| PubChem CID | 10888998 |
| Molecular Formula | C11H15F3 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | (3E,5E)-2-(trifluoromethyl)deca-1,3,5-triene |
| SMILES | C=C(/C=C/C=C/CCCC)C(F)(F)F |
| InChI | InChI=1S/C11H15F3/c1-3-4-5-6-7-8-9-10(2)11(12,13)14/h6-9H,2-5H2,1H3/b7-6+,9-8+ |
| InChIKey | QHUAVRJDXHPIQU-BLHCBFLLSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|