C18H30N2 — CID 143346853
3-[3-ethyl-2-(ethylideneamino)-5-methylcyclopent-3-en-1-yl]-N-(2-methylpropyl)buta-1,3-dien-2-amine (PubChem CID 143346853) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is 3-[3-ethyl-2-(ethylideneamino)-5-methylcyclopent-3-en-1-yl]-N-(2-methylpropyl)buta-1,3-dien-2-amine.
| Compound Name | 3-[3-ethyl-2-(ethylideneamino)-5-methylcyclopent-3-en-1-yl]-N-(2-methylpropyl)buta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 143346853 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | 3-[3-ethyl-2-(ethylideneamino)-5-methylcyclopent-3-en-1-yl]-N-(2-methylpropyl)buta-1,3-dien-2-amine |
| SMILES | C=C(NCC(C)C)C(=C)C1C(C)C=C(CC)C1/N=C/C |
| InChI | InChI=1S/C18H30N2/c1-8-16-10-13(5)17(18(16)19-9-2)14(6)15(7)20-11-12(3)4/h9-10,12-13,17-18,20H,6-8,11H2,1-5H3/b19-9+ |
| InChIKey | LNRVVSRPEIEHCZ-DJKKODMXSA-N |
| XLogP | 4.36 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|