C34H59N3 — CID 143346852
ethane;5-ethenyl-6-ethyl-2-ethynyl-2-methyl-3,4-dihydro-1H-pyridine;3-[3-ethyl-2-(ethylideneamino)-5-methylcyclopent-3-en-1-yl]-N-(2-methylpropyl)buta-1,3-dien-2-amine (PubChem CID 143346852) has the molecular formula C34H59N3 and a molecular weight of 509.87 g/mol. Its IUPAC name is ethane;5-ethenyl-6-ethyl-2-ethynyl-2-methyl-3,4-dihydro-1H-pyridine;3-[3-ethyl-2-(ethylideneamino)-5-methylcyclopent-3-en-1-yl]-N-(2-methylpropyl)buta-1,3-dien-2-amine.
| Compound Name | ethane;5-ethenyl-6-ethyl-2-ethynyl-2-methyl-3,4-dihydro-1H-pyridine;3-[3-ethyl-2-(ethylideneamino)-5-methylcyclopent-3-en-1-yl]-N-(2-methylpropyl)buta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 143346852 |
| Molecular Formula | C34H59N3 |
| Molecular Weight | 509.87 g/mol |
| Exact Mass | 509.47 |
| IUPAC Name | ethane;5-ethenyl-6-ethyl-2-ethynyl-2-methyl-3,4-dihydro-1H-pyridine;3-[3-ethyl-2-(ethylideneamino)-5-methylcyclopent-3-en-1-yl]-N-(2-methylpropyl)buta-1,3-dien-2-amine |
| SMILES | C#CC1(C)CCC(C=C)=C(CC)N1.C=C(NCC(C)C)C(=C)C1C(C)C=C(CC)C1/N=C/C.CC.CC |
| InChI | InChI=1S/C18H30N2.C12H17N.2C2H6/c1-8-16-10-13(5)17(18(16)19-9-2)14(6)15(7)20-11-12(3)4;1-5-10-8-9-12(4,7-3)13-11(10)6-2;2*1-2/h9-10,12-13,17-18,20H,6-8,11H2,1-5H3;3,5,13H,1,6,8-9H2,2,4H3;2*1-2H3/b19-9+;;; |
| InChIKey | KDRDBTRGSMHMSV-PWVZHKMWSA-N |
| XLogP | 9.03 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.87 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|