C14H21ClN2 — CID 143571483
(1S)-1-(1-chloro-5,6,7,8-tetrahydroisoquinolin-4-yl)-N-methylbutan-1-amine (PubChem CID 143571483) has the molecular formula C14H21ClN2 and a molecular weight of 252.79 g/mol. Its IUPAC name is (1S)-1-(1-chloro-5,6,7,8-tetrahydroisoquinolin-4-yl)-N-methylbutan-1-amine.
| Compound Name | (1S)-1-(1-chloro-5,6,7,8-tetrahydroisoquinolin-4-yl)-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 143571483 |
| Molecular Formula | C14H21ClN2 |
| Molecular Weight | 252.79 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (1S)-1-(1-chloro-5,6,7,8-tetrahydroisoquinolin-4-yl)-N-methylbutan-1-amine |
| SMILES | CCC[C@H](NC)c1cnc(Cl)c2c1CCCC2 |
| InChI | InChI=1S/C14H21ClN2/c1-3-6-13(16-2)12-9-17-14(15)11-8-5-4-7-10(11)12/h9,13,16H,3-8H2,1-2H3/t13-/m0/s1 |
| InChIKey | HDTFKWVFHBUBQP-ZDUSSCGKSA-N |
| XLogP | 3.67 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.79 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|