C22H24N6OS2 — CID 143571629
[4-(1,3-benzoxazol-2-yl)-1,4-diazepan-1-yl]-[5-methyl-2-(triazol-2-yl)phenyl]methanethione;sulfane (PubChem CID 143571629) has the molecular formula C22H24N6OS2 and a molecular weight of 452.61 g/mol. Its IUPAC name is [4-(1,3-benzoxazol-2-yl)-1,4-diazepan-1-yl]-[5-methyl-2-(triazol-2-yl)phenyl]methanethione;sulfane.
| Compound Name | [4-(1,3-benzoxazol-2-yl)-1,4-diazepan-1-yl]-[5-methyl-2-(triazol-2-yl)phenyl]methanethione;sulfane |
|---|---|
| PubChem CID | 143571629 |
| Molecular Formula | C22H24N6OS2 |
| Molecular Weight | 452.61 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | [4-(1,3-benzoxazol-2-yl)-1,4-diazepan-1-yl]-[5-methyl-2-(triazol-2-yl)phenyl]methanethione;sulfane |
| SMILES | Cc1ccc(-n2nccn2)c(C(=S)N2CCCN(c3nc4ccccc4o3)CC2)c1.S |
| InChI | InChI=1S/C22H22N6OS.H2S/c1-16-7-8-19(28-23-9-10-24-28)17(15-16)21(30)26-11-4-12-27(14-13-26)22-25-18-5-2-3-6-20(18)29-22;/h2-3,5-10,15H,4,11-14H2,1H3;1H2 |
| InChIKey | WOJPTOAMGGJEFE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.61 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|