C9H14N2O — CID 143571918
N-[(3Z)-3-[(methylideneamino)methylidene]pent-4-enyl]acetamide (PubChem CID 143571918) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is N-[(3Z)-3-[(methylideneamino)methylidene]pent-4-enyl]acetamide.
| Compound Name | N-[(3Z)-3-[(methylideneamino)methylidene]pent-4-enyl]acetamide |
|---|---|
| PubChem CID | 143571918 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | N-[(3Z)-3-[(methylideneamino)methylidene]pent-4-enyl]acetamide |
| SMILES | C=C/C(=C\N=C)CCNC(C)=O |
| InChI | InChI=1S/C9H14N2O/c1-4-9(7-10-3)5-6-11-8(2)12/h4,7H,1,3,5-6H2,2H3,(H,11,12)/b9-7+ |
| InChIKey | DMZBOGGHTGUNAG-VQHVLOKHSA-N |
| XLogP | 1.28 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|