C11H22N2O — CID 142506487
ethane;N-[(Z)-5-(methylamino)-3-methylidenepent-4-enyl]acetamide (PubChem CID 142506487) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is ethane;N-[(Z)-5-(methylamino)-3-methylidenepent-4-enyl]acetamide.
| Compound Name | ethane;N-[(Z)-5-(methylamino)-3-methylidenepent-4-enyl]acetamide |
|---|---|
| PubChem CID | 142506487 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | ethane;N-[(Z)-5-(methylamino)-3-methylidenepent-4-enyl]acetamide |
| SMILES | C=C(/C=C\NC)CCNC(C)=O.CC |
| InChI | InChI=1S/C9H16N2O.C2H6/c1-8(4-6-10-3)5-7-11-9(2)12;1-2/h4,6,10H,1,5,7H2,2-3H3,(H,11,12);1-2H3/b6-4-; |
| InChIKey | VHSFUJPMSWYADK-YHSAGPEESA-N |
| XLogP | 1.83 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|