C16H22N2O — CID 143573125
3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-(3-methylbutyl)-1H-pyridazin-6-one (PubChem CID 143573125) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is 3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-(3-methylbutyl)-1H-pyridazin-6-one.
| Compound Name | 3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-(3-methylbutyl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 143573125 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-(3-methylbutyl)-1H-pyridazin-6-one |
| SMILES | C=C/C=C(\C=C/C)c1cc(CCC(C)C)c(=O)[nH]n1 |
| InChI | InChI=1S/C16H22N2O/c1-5-7-13(8-6-2)15-11-14(10-9-12(3)4)16(19)18-17-15/h5-8,11-12H,1,9-10H2,2-4H3,(H,18,19)/b8-6-,13-7+ |
| InChIKey | ZLXIHEKUQHNYQC-WNDPTYLVSA-N |
| XLogP | 3.50 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|