C29H29NO2 — CID 143574813
23-cyclohexyl-16-azapentacyclo[14.7.0.02,7.08,14.017,22]tricosa-1(23),2,4,6,8(14),11,17(22),18,20-nonaene-19-carboxylic acid (PubChem CID 143574813) has the molecular formula C29H29NO2 and a molecular weight of 423.56 g/mol. Its IUPAC name is 23-cyclohexyl-16-azapentacyclo[14.7.0.02,7.08,14.017,22]tricosa-1(23),2,4,6,8(14),11,17(22),18,20-nonaene-19-carboxylic acid.
| Compound Name | 23-cyclohexyl-16-azapentacyclo[14.7.0.02,7.08,14.017,22]tricosa-1(23),2,4,6,8(14),11,17(22),18,20-nonaene-19-carboxylic acid |
|---|---|
| PubChem CID | 143574813 |
| Molecular Formula | C29H29NO2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 23-cyclohexyl-16-azapentacyclo[14.7.0.02,7.08,14.017,22]tricosa-1(23),2,4,6,8(14),11,17(22),18,20-nonaene-19-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(C3CCCCC3)c3n(c2c1)CC1=C(CCC=CC1)c1ccccc1-3 |
| InChI | InChI=1S/C29H29NO2/c31-29(32)20-15-16-25-26(17-20)30-18-21-11-5-2-6-12-22(21)23-13-7-8-14-24(23)28(30)27(25)19-9-3-1-4-10-19/h2,5,7-8,13-17,19H,1,3-4,6,9-12,18H2,(H,31,32) |
| InChIKey | VTDASABGUSYWIN-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|