C21H32N8O2 — CID 143575013
1-[2-[[4-[[4-(5-amino-1-methylpyrazol-4-yl)pyrimidin-2-yl]amino]cyclohexyl]amino]-2-hydroxyethyl]piperidin-2-one (PubChem CID 143575013) has the molecular formula C21H32N8O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 1-[2-[[4-[[4-(5-amino-1-methylpyrazol-4-yl)pyrimidin-2-yl]amino]cyclohexyl]amino]-2-hydroxyethyl]piperidin-2-one.
| Compound Name | 1-[2-[[4-[[4-(5-amino-1-methylpyrazol-4-yl)pyrimidin-2-yl]amino]cyclohexyl]amino]-2-hydroxyethyl]piperidin-2-one |
|---|---|
| PubChem CID | 143575013 |
| Molecular Formula | C21H32N8O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | 1-[2-[[4-[[4-(5-amino-1-methylpyrazol-4-yl)pyrimidin-2-yl]amino]cyclohexyl]amino]-2-hydroxyethyl]piperidin-2-one |
| SMILES | Cn1ncc(-c2ccnc(NC3CCC(NC(O)CN4CCCCC4=O)CC3)n2)c1N |
| InChI | InChI=1S/C21H32N8O2/c1-28-20(22)16(12-24-28)17-9-10-23-21(27-17)26-15-7-5-14(6-8-15)25-18(30)13-29-11-3-2-4-19(29)31/h9-10,12,14-15,18,25,30H,2-8,11,13,22H2,1H3,(H,23,26,27) |
| InChIKey | GSAJZCRLQGEVRW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 134.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|