C18H20N4 — CID 143575918
6-phenyl-N-[(1-prop-2-ynylpyrrolidin-2-yl)methyl]pyridazin-3-amine (PubChem CID 143575918) has the molecular formula C18H20N4 and a molecular weight of 292.39 g/mol. Its IUPAC name is 6-phenyl-N-[(1-prop-2-ynylpyrrolidin-2-yl)methyl]pyridazin-3-amine.
| Compound Name | 6-phenyl-N-[(1-prop-2-ynylpyrrolidin-2-yl)methyl]pyridazin-3-amine |
|---|---|
| PubChem CID | 143575918 |
| Molecular Formula | C18H20N4 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 6-phenyl-N-[(1-prop-2-ynylpyrrolidin-2-yl)methyl]pyridazin-3-amine |
| SMILES | C#CCN1CCCC1CNc1ccc(-c2ccccc2)nn1 |
| InChI | InChI=1S/C18H20N4/c1-2-12-22-13-6-9-16(22)14-19-18-11-10-17(20-21-18)15-7-4-3-5-8-15/h1,3-5,7-8,10-11,16H,6,9,12-14H2,(H,19,21) |
| InChIKey | JVWUKBYSZJBWGK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|