C13H20N6 — CID 143576918
N'-[1-[2-(3-methylphenyl)tetrazol-5-yl]ethyl]propane-1,3-diamine (PubChem CID 143576918) has the molecular formula C13H20N6 and a molecular weight of 260.34 g/mol. Its IUPAC name is N'-[1-[2-(3-methylphenyl)tetrazol-5-yl]ethyl]propane-1,3-diamine.
| Compound Name | N'-[1-[2-(3-methylphenyl)tetrazol-5-yl]ethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 143576918 |
| Molecular Formula | C13H20N6 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | N'-[1-[2-(3-methylphenyl)tetrazol-5-yl]ethyl]propane-1,3-diamine |
| SMILES | Cc1cccc(-n2nnc(C(C)NCCCN)n2)c1 |
| InChI | InChI=1S/C13H20N6/c1-10-5-3-6-12(9-10)19-17-13(16-18-19)11(2)15-8-4-7-14/h3,5-6,9,11,15H,4,7-8,14H2,1-2H3 |
| InChIKey | FIANWQJSIMJWAU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|