C18H14N2O2 — CID 143578998
2-[(E)-3-(3-methylphenyl)prop-2-enoyl]-3H-quinazolin-4-one (PubChem CID 143578998) has the molecular formula C18H14N2O2 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-[(E)-3-(3-methylphenyl)prop-2-enoyl]-3H-quinazolin-4-one.
| Compound Name | 2-[(E)-3-(3-methylphenyl)prop-2-enoyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 143578998 |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-[(E)-3-(3-methylphenyl)prop-2-enoyl]-3H-quinazolin-4-one |
| SMILES | Cc1cccc(/C=C/C(=O)c2nc3ccccc3c(=O)[nH]2)c1 |
| InChI | InChI=1S/C18H14N2O2/c1-12-5-4-6-13(11-12)9-10-16(21)17-19-15-8-3-2-7-14(15)18(22)20-17/h2-11H,1H3,(H,19,20,22)/b10-9+ |
| InChIKey | AWBJOIVXQCRKCC-MDZDMXLPSA-N |
| XLogP | 3.13 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|