C18H19ClFN3OS — CID 143579697
1-[(Z)-2-(2-chloro-4-pyridinyl)-2-(methylideneamino)ethenyl]sulfanyl-N-methylmethanamine;2-(4-fluorophenyl)acetaldehyde (PubChem CID 143579697) has the molecular formula C18H19ClFN3OS and a molecular weight of 379.89 g/mol. Its IUPAC name is 1-[(Z)-2-(2-chloro-4-pyridinyl)-2-(methylideneamino)ethenyl]sulfanyl-N-methylmethanamine;2-(4-fluorophenyl)acetaldehyde.
| Compound Name | 1-[(Z)-2-(2-chloro-4-pyridinyl)-2-(methylideneamino)ethenyl]sulfanyl-N-methylmethanamine;2-(4-fluorophenyl)acetaldehyde |
|---|---|
| PubChem CID | 143579697 |
| Molecular Formula | C18H19ClFN3OS |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 1-[(Z)-2-(2-chloro-4-pyridinyl)-2-(methylideneamino)ethenyl]sulfanyl-N-methylmethanamine;2-(4-fluorophenyl)acetaldehyde |
| SMILES | C=N/C(=C\SCNC)c1ccnc(Cl)c1.O=CCc1ccc(F)cc1 |
| InChI | InChI=1S/C10H12ClN3S.C8H7FO/c1-12-7-15-6-9(13-2)8-3-4-14-10(11)5-8;9-8-3-1-7(2-4-8)5-6-10/h3-6,12H,2,7H2,1H3;1-4,6H,5H2/b9-6-; |
| InChIKey | QZRZHDUTZVXJRQ-BORNJIKYSA-N |
| XLogP | 4.21 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|