C14H15NO — CID 143579821
3-(6-methylnaphthalen-2-yl)-1,3-oxazolidine (PubChem CID 143579821) has the molecular formula C14H15NO and a molecular weight of 213.28 g/mol. Its IUPAC name is 3-(6-methylnaphthalen-2-yl)-1,3-oxazolidine.
| Compound Name | 3-(6-methylnaphthalen-2-yl)-1,3-oxazolidine |
|---|---|
| PubChem CID | 143579821 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 3-(6-methylnaphthalen-2-yl)-1,3-oxazolidine |
| SMILES | Cc1ccc2cc(N3CCOC3)ccc2c1 |
| InChI | InChI=1S/C14H15NO/c1-11-2-3-13-9-14(5-4-12(13)8-11)15-6-7-16-10-15/h2-5,8-9H,6-7,10H2,1H3 |
| InChIKey | PPRXSJAQLXVVHW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |