C28H43N3O2 — CID 143580048
ethane;(2R)-2-[5-ethyl-6-(2-methoxy-6-propan-2-yl-3-pyridinyl)-1-methylpyrrolo[2,3-b]pyridin-3-yl]heptan-1-ol (PubChem CID 143580048) has the molecular formula C28H43N3O2 and a molecular weight of 453.67 g/mol. Its IUPAC name is ethane;(2R)-2-[5-ethyl-6-(2-methoxy-6-propan-2-yl-3-pyridinyl)-1-methylpyrrolo[2,3-b]pyridin-3-yl]heptan-1-ol.
| Compound Name | ethane;(2R)-2-[5-ethyl-6-(2-methoxy-6-propan-2-yl-3-pyridinyl)-1-methylpyrrolo[2,3-b]pyridin-3-yl]heptan-1-ol |
|---|---|
| PubChem CID | 143580048 |
| Molecular Formula | C28H43N3O2 |
| Molecular Weight | 453.67 g/mol |
| Exact Mass | 453.34 |
| IUPAC Name | ethane;(2R)-2-[5-ethyl-6-(2-methoxy-6-propan-2-yl-3-pyridinyl)-1-methylpyrrolo[2,3-b]pyridin-3-yl]heptan-1-ol |
| SMILES | CC.CCCCC[C@@H](CO)c1cn(C)c2nc(-c3ccc(C(C)C)nc3OC)c(CC)cc12 |
| InChI | InChI=1S/C26H37N3O2.C2H6/c1-7-9-10-11-19(16-30)22-15-29(5)25-21(22)14-18(8-2)24(28-25)20-12-13-23(17(3)4)27-26(20)31-6;1-2/h12-15,17,19,30H,7-11,16H2,1-6H3;1-2H3/t19-;/m0./s1 |
| InChIKey | WKPWYJASNCXNAC-FYZYNONXSA-N |
| XLogP | 7.01 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.67 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|