C27H35N3O — CID 143580333
5-(2-methoxy-6-propan-2-yl-3-pyridinyl)-1,3,6-trimethylpyrrolo[3,2-b]pyridine;(2Z,4Z,6E)-octa-2,4,6-triene (PubChem CID 143580333) has the molecular formula C27H35N3O and a molecular weight of 417.60 g/mol. Its IUPAC name is 5-(2-methoxy-6-propan-2-yl-3-pyridinyl)-1,3,6-trimethylpyrrolo[3,2-b]pyridine;(2Z,4Z,6E)-octa-2,4,6-triene.
| Compound Name | 5-(2-methoxy-6-propan-2-yl-3-pyridinyl)-1,3,6-trimethylpyrrolo[3,2-b]pyridine;(2Z,4Z,6E)-octa-2,4,6-triene |
|---|---|
| PubChem CID | 143580333 |
| Molecular Formula | C27H35N3O |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.28 |
| IUPAC Name | 5-(2-methoxy-6-propan-2-yl-3-pyridinyl)-1,3,6-trimethylpyrrolo[3,2-b]pyridine;(2Z,4Z,6E)-octa-2,4,6-triene |
| SMILES | C/C=C\C=C/C=C/C.COc1nc(C(C)C)ccc1-c1nc2c(C)cn(C)c2cc1C |
| InChI | InChI=1S/C19H23N3O.C8H12/c1-11(2)15-8-7-14(19(20-15)23-6)17-12(3)9-16-18(21-17)13(4)10-22(16)5;1-3-5-7-8-6-4-2/h7-11H,1-6H3;3-8H,1-2H3/b;5-3-,6-4+,8-7- |
| InChIKey | QRICNAFRPNNQSB-XTFHDSCWSA-N |
| XLogP | 7.08 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|