C23H33N3O2 — CID 143580486
5-(6-ethoxy-2-ethyl-3-pyridinyl)-3,6-dimethyl-1H-pyrrolo[3,2-b]pyridine;pentan-1-ol (PubChem CID 143580486) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is 5-(6-ethoxy-2-ethyl-3-pyridinyl)-3,6-dimethyl-1H-pyrrolo[3,2-b]pyridine;pentan-1-ol.
| Compound Name | 5-(6-ethoxy-2-ethyl-3-pyridinyl)-3,6-dimethyl-1H-pyrrolo[3,2-b]pyridine;pentan-1-ol |
|---|---|
| PubChem CID | 143580486 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | 5-(6-ethoxy-2-ethyl-3-pyridinyl)-3,6-dimethyl-1H-pyrrolo[3,2-b]pyridine;pentan-1-ol |
| SMILES | CCCCCO.CCOc1ccc(-c2nc3c(C)c[nH]c3cc2C)c(CC)n1 |
| InChI | InChI=1S/C18H21N3O.C5H12O/c1-5-14-13(7-8-16(20-14)22-6-2)17-11(3)9-15-18(21-17)12(4)10-19-15;1-2-3-4-5-6/h7-10,19H,5-6H2,1-4H3;6H,2-5H2,1H3 |
| InChIKey | NWZPDUMMHCGTGC-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|