C17H13ClFN3O2 — CID 143582194
2-[3-(4-chlorophenyl)-4-[(2-fluorophenyl)methyl]-5-oxo-1,2,4-triazol-1-yl]acetaldehyde (PubChem CID 143582194) has the molecular formula C17H13ClFN3O2 and a molecular weight of 345.76 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-4-[(2-fluorophenyl)methyl]-5-oxo-1,2,4-triazol-1-yl]acetaldehyde.
| Compound Name | 2-[3-(4-chlorophenyl)-4-[(2-fluorophenyl)methyl]-5-oxo-1,2,4-triazol-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 143582194 |
| Molecular Formula | C17H13ClFN3O2 |
| Molecular Weight | 345.76 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-4-[(2-fluorophenyl)methyl]-5-oxo-1,2,4-triazol-1-yl]acetaldehyde |
| SMILES | O=CCn1nc(-c2ccc(Cl)cc2)n(Cc2ccccc2F)c1=O |
| InChI | InChI=1S/C17H13ClFN3O2/c18-14-7-5-12(6-8-14)16-20-22(9-10-23)17(24)21(16)11-13-3-1-2-4-15(13)19/h1-8,10H,9,11H2 |
| InChIKey | BNGRETUROCUFRR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.76 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|