C24H36N2O6 — CID 143582537
(E,2R,3S,4S,5R)-3,4,5-trihydroxy-2,8,8-trimethyl-N-(4-oxo-5-propyl-2,3-dihydro-1,5-benzoxazepin-3-yl)non-6-enamide (PubChem CID 143582537) has the molecular formula C24H36N2O6 and a molecular weight of 448.56 g/mol. Its IUPAC name is (E,2R,3S,4S,5R)-3,4,5-trihydroxy-2,8,8-trimethyl-N-(4-oxo-5-propyl-2,3-dihydro-1,5-benzoxazepin-3-yl)non-6-enamide.
| Compound Name | (E,2R,3S,4S,5R)-3,4,5-trihydroxy-2,8,8-trimethyl-N-(4-oxo-5-propyl-2,3-dihydro-1,5-benzoxazepin-3-yl)non-6-enamide |
|---|---|
| PubChem CID | 143582537 |
| Molecular Formula | C24H36N2O6 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | (E,2R,3S,4S,5R)-3,4,5-trihydroxy-2,8,8-trimethyl-N-(4-oxo-5-propyl-2,3-dihydro-1,5-benzoxazepin-3-yl)non-6-enamide |
| SMILES | CCCN1C(=O)C(NC(=O)[C@H](C)[C@H](O)[C@@H](O)[C@H](O)/C=C/C(C)(C)C)COc2ccccc21 |
| InChI | InChI=1S/C24H36N2O6/c1-6-13-26-17-9-7-8-10-19(17)32-14-16(23(26)31)25-22(30)15(2)20(28)21(29)18(27)11-12-24(3,4)5/h7-12,15-16,18,20-21,27-29H,6,13-14H2,1-5H3,(H,25,30)/b12-11+/t15-,16?,18-,20+,21+/m1/s1 |
| InChIKey | CIWUCBHLIRWCKT-IMBZFKSPSA-N |
| XLogP | 1.63 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|