C34H38FN3O4 — CID 143582818
ethanamine;2-[3-[4-(4-ethyl-2-phenylmethoxyphenoxy)-3-fluoroanilino]propyl]-4,5-dihydroisoindole-1,3-dione (PubChem CID 143582818) has the molecular formula C34H38FN3O4 and a molecular weight of 571.69 g/mol. Its IUPAC name is ethanamine;2-[3-[4-(4-ethyl-2-phenylmethoxyphenoxy)-3-fluoroanilino]propyl]-4,5-dihydroisoindole-1,3-dione.
| Compound Name | ethanamine;2-[3-[4-(4-ethyl-2-phenylmethoxyphenoxy)-3-fluoroanilino]propyl]-4,5-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 143582818 |
| Molecular Formula | C34H38FN3O4 |
| Molecular Weight | 571.69 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | ethanamine;2-[3-[4-(4-ethyl-2-phenylmethoxyphenoxy)-3-fluoroanilino]propyl]-4,5-dihydroisoindole-1,3-dione |
| SMILES | CCN.CCc1ccc(Oc2ccc(NCCCN3C(=O)C4=C(CCC=C4)C3=O)cc2F)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C32H31FN2O4.C2H7N/c1-2-22-13-15-29(30(19-22)38-21-23-9-4-3-5-10-23)39-28-16-14-24(20-27(28)33)34-17-8-18-35-31(36)25-11-6-7-12-26(25)32(35)37;1-2-3/h3-6,9-11,13-16,19-20,34H,2,7-8,12,17-18,21H2,1H3;2-3H2,1H3 |
| InChIKey | YJWPGQVJUBHNMV-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.69 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|