C42H50F2N2O6 — CID 159701037
5-ethyl-2-[2-fluoro-4-(3-hydroxypropylamino)phenoxy]phenol;3-[4-(4-ethyl-2-phenylmethoxyphenoxy)-3-fluoroanilino]propan-1-ol;methane (PubChem CID 159701037) has the molecular formula C42H50F2N2O6 and a molecular weight of 716.87 g/mol. Its IUPAC name is 5-ethyl-2-[2-fluoro-4-(3-hydroxypropylamino)phenoxy]phenol;3-[4-(4-ethyl-2-phenylmethoxyphenoxy)-3-fluoroanilino]propan-1-ol;methane.
| Compound Name | 5-ethyl-2-[2-fluoro-4-(3-hydroxypropylamino)phenoxy]phenol;3-[4-(4-ethyl-2-phenylmethoxyphenoxy)-3-fluoroanilino]propan-1-ol;methane |
|---|---|
| PubChem CID | 159701037 |
| Molecular Formula | C42H50F2N2O6 |
| Molecular Weight | 716.87 g/mol |
| Exact Mass | 716.36 |
| IUPAC Name | 5-ethyl-2-[2-fluoro-4-(3-hydroxypropylamino)phenoxy]phenol;3-[4-(4-ethyl-2-phenylmethoxyphenoxy)-3-fluoroanilino]propan-1-ol;methane |
| SMILES | C.CCc1ccc(Oc2ccc(NCCCO)cc2F)c(O)c1.CCc1ccc(Oc2ccc(NCCCO)cc2F)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C24H26FNO3.C17H20FNO3.CH4/c1-2-18-9-11-23(24(15-18)28-17-19-7-4-3-5-8-19)29-22-12-10-20(16-21(22)25)26-13-6-14-27;1-2-12-4-6-17(15(21)10-12)22-16-7-5-13(11-14(16)18)19-8-3-9-20;/h3-5,7-12,15-16,26-27H,2,6,13-14,17H2,1H3;4-7,10-11,19-21H,2-3,8-9H2,1H3;1H4 |
| InChIKey | MXPUURXSZDZNKN-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 112.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.87 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|