C16H18FNO4S — CID 59191345
N-ethyl-4-(4-ethyl-2-hydroxyphenoxy)-3-fluorobenzenesulfonamide (PubChem CID 59191345) has the molecular formula C16H18FNO4S and a molecular weight of 339.39 g/mol. Its IUPAC name is N-ethyl-4-(4-ethyl-2-hydroxyphenoxy)-3-fluorobenzenesulfonamide.
| Compound Name | N-ethyl-4-(4-ethyl-2-hydroxyphenoxy)-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 59191345 |
| Molecular Formula | C16H18FNO4S |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | N-ethyl-4-(4-ethyl-2-hydroxyphenoxy)-3-fluorobenzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1ccc(Oc2ccc(CC)cc2O)c(F)c1 |
| InChI | InChI=1S/C16H18FNO4S/c1-3-11-5-7-16(14(19)9-11)22-15-8-6-12(10-13(15)17)23(20,21)18-4-2/h5-10,18-19H,3-4H2,1-2H3 |
| InChIKey | XYTCBLSVAGLDPL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |