C46H48F3N3O8 — CID 157184786
2-(4-amino-2-fluorophenoxy)-5-ethylphenol;N-ethyl-4-(4-ethyl-2-methoxyphenoxy)-3-fluoroaniline;4-ethyl-1-(2-fluoro-4-nitrophenoxy)-2-methoxybenzene (PubChem CID 157184786) has the molecular formula C46H48F3N3O8 and a molecular weight of 827.90 g/mol. Its IUPAC name is 2-(4-amino-2-fluorophenoxy)-5-ethylphenol;N-ethyl-4-(4-ethyl-2-methoxyphenoxy)-3-fluoroaniline;4-ethyl-1-(2-fluoro-4-nitrophenoxy)-2-methoxybenzene.
| Compound Name | 2-(4-amino-2-fluorophenoxy)-5-ethylphenol;N-ethyl-4-(4-ethyl-2-methoxyphenoxy)-3-fluoroaniline;4-ethyl-1-(2-fluoro-4-nitrophenoxy)-2-methoxybenzene |
|---|---|
| PubChem CID | 157184786 |
| Molecular Formula | C46H48F3N3O8 |
| Molecular Weight | 827.90 g/mol |
| Exact Mass | 827.34 |
| IUPAC Name | 2-(4-amino-2-fluorophenoxy)-5-ethylphenol;N-ethyl-4-(4-ethyl-2-methoxyphenoxy)-3-fluoroaniline;4-ethyl-1-(2-fluoro-4-nitrophenoxy)-2-methoxybenzene |
| SMILES | CCNc1ccc(Oc2ccc(CC)cc2OC)c(F)c1.CCc1ccc(Oc2ccc(N)cc2F)c(O)c1.CCc1ccc(Oc2ccc([N+](=O)[O-])cc2F)c(OC)c1 |
| InChI | InChI=1S/C17H20FNO2.C15H14FNO4.C14H14FNO2/c1-4-12-6-8-16(17(10-12)20-3)21-15-9-7-13(19-5-2)11-14(15)18;1-3-10-4-6-14(15(8-10)20-2)21-13-7-5-11(17(18)19)9-12(13)16;1-2-9-3-5-14(12(17)7-9)18-13-6-4-10(16)8-11(13)15/h6-11,19H,4-5H2,1-3H3;4-9H,3H2,1-2H3;3-8,17H,2,16H2,1H3 |
| InChIKey | AOZKWTKLPDPZPK-UHFFFAOYSA-N |
| XLogP | 12.19 |
| TPSA | 147.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.90 |
| LogP ≤ 5 | 12.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|