C23H44N4 — CID 143582964
6-methyl-1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridine;7-methyl-7-azabicyclo[2.2.1]heptane;2-methyl-2-azabicyclo[2.2.2]octane (PubChem CID 143582964) has the molecular formula C23H44N4 and a molecular weight of 376.63 g/mol. Its IUPAC name is 6-methyl-1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridine;7-methyl-7-azabicyclo[2.2.1]heptane;2-methyl-2-azabicyclo[2.2.2]octane.
| Compound Name | 6-methyl-1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridine;7-methyl-7-azabicyclo[2.2.1]heptane;2-methyl-2-azabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 143582964 |
| Molecular Formula | C23H44N4 |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 376.36 |
| IUPAC Name | 6-methyl-1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridine;7-methyl-7-azabicyclo[2.2.1]heptane;2-methyl-2-azabicyclo[2.2.2]octane |
| SMILES | CN1C2CCC1CC2.CN1CC2CCC1CC2.CN1CCC2CCNC2C1 |
| InChI | InChI=1S/C8H16N2.C8H15N.C7H13N/c1-10-5-3-7-2-4-9-8(7)6-10;1-9-6-7-2-4-8(9)5-3-7;1-8-6-2-3-7(8)5-4-6/h7-9H,2-6H2,1H3;7-8H,2-6H2,1H3;6-7H,2-5H2,1H3 |
| InChIKey | YIFKVDKXAXUYNH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |