About 2-azabicyclo[2.2.1]heptane;7-azabicyclo[2.2.1]heptane;2-azabicyclo[2.2.2]octane;ethane
2-azabicyclo[2.2.1]heptane;7-azabicyclo[2.2.1]heptane;2-azabicyclo[2.2.2]octane;ethane (PubChem CID 159110091) has the molecular formula C25H53N3
and a molecular weight of 395.72 g/mol. Its IUPAC name is 2-azabicyclo[2.2.1]heptane;7-azabicyclo[2.2.1]heptane;2-azabicyclo[2.2.2]octane;ethane.
Molecular Properties
| Compound Name | 2-azabicyclo[2.2.1]heptane;7-azabicyclo[2.2.1]heptane;2-azabicyclo[2.2.2]octane;ethane |
| PubChem CID | 159110091 |
| Molecular Formula | C25H53N3 |
| Molecular Weight | 395.72 g/mol |
| Exact Mass | 395.42 |
| IUPAC Name | 2-azabicyclo[2.2.1]heptane;7-azabicyclo[2.2.1]heptane;2-azabicyclo[2.2.2]octane;ethane |
| SMILES | C1CC2CC1CN2.C1CC2CCC1CN2.C1CC2CCC1N2.CC.CC.CC |
| InChI | InChI=1S/C7H13N.2C6H11N.3C2H6/c1-3-7-4-2-6(1)5-8-7;1-2-6-3-5(1)4-7-6;1-2-6-4-3-5(1)7-6;3*1-2/h6-8H,1-5H2;2*5-7H,1-4H2;3*1-2H3 |
| InChIKey | KEJNDEDNDOKPLU-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.72 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-azabicyclo[2.2.1]heptane;7-azabicyclo[2.2.1]heptane;2-azabicyclo[2.2.2]octane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azabicyclo[2.2.1]heptane;7-azabicyclo[2.2.1]heptane;2-azabicyclo[2.2.2]octane;ethane?
The IUPAC name of 2-azabicyclo[2.2.1]heptane;7-azabicyclo[2.2.1]heptane;2-azabicyclo[2.2.2]octane;ethane (CID 159110091) is 2-azabicyclo[2.2.1]heptane;7-azabicyclo[2.2.1]heptane;2-azabicyclo[2.2.2]octane;ethane.
What is the SMILES notation for 2-azabicyclo[2.2.1]heptane;7-azabicyclo[2.2.1]heptane;2-azabicyclo[2.2.2]octane;ethane?
The canonical SMILES for 2-azabicyclo[2.2.1]heptane;7-azabicyclo[2.2.1]heptane;2-azabicyclo[2.2.2]octane;ethane is C1CC2CC1CN2.C1CC2CCC1CN2.C1CC2CCC1N2.CC.CC.CC.
What is the InChIKey of 2-azabicyclo[2.2.1]heptane;7-azabicyclo[2.2.1]heptane;2-azabicyclo[2.2.2]octane;ethane?
The InChIKey is KEJNDEDNDOKPLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N.2C6H11N.3C2H6/c1-3-7-4-2-6(1)5-8-7;1-2-6-3-5(1)4-7-6;1-2-6-4-3-5(1)7-6;3*1-2/h6-8H,1-5H2;2*5-7H,1-4H2;3*1-2H3.
What are the key properties of 2-azabicyclo[2.2.1]heptane;7-azabicyclo[2.2.1]heptane;2-azabicyclo[2.2.2]octane;ethane?
2-azabicyclo[2.2.1]heptane;7-azabicyclo[2.2.1]heptane;2-azabicyclo[2.2.2]octane;ethane has a molecular weight of 395.72 g/mol, XLogP of 5.89, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azabicyclo[2.2.1]heptane;7-azabicyclo[2.2.1]heptane;2-azabicyclo[2.2.2]octane;ethane is sourced from PubChem (CID 159110091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).