C29H33F7N2O3 — CID 143583454
[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl]-morpholin-4-ylmethanone;fluorobenzene (PubChem CID 143583454) has the molecular formula C29H33F7N2O3 and a molecular weight of 590.58 g/mol. Its IUPAC name is [2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl]-morpholin-4-ylmethanone;fluorobenzene.
| Compound Name | [2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl]-morpholin-4-ylmethanone;fluorobenzene |
|---|---|
| PubChem CID | 143583454 |
| Molecular Formula | C29H33F7N2O3 |
| Molecular Weight | 590.58 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | [2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl]-morpholin-4-ylmethanone;fluorobenzene |
| SMILES | CC1C(OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)CN2CCC(C(=O)N3CCOCC3)CC12.Fc1ccccc1 |
| InChI | InChI=1S/C23H28F6N2O3.C6H5F/c1-14-19-10-16(21(32)30-4-6-33-7-5-30)2-3-31(19)12-20(14)34-13-15-8-17(22(24,25)26)11-18(9-15)23(27,28)29;7-6-4-2-1-3-5-6/h8-9,11,14,16,19-20H,2-7,10,12-13H2,1H3;1-5H |
| InChIKey | ZSXPLVLPKKSXTQ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.58 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |