C31H37F7N2O2 — CID 143583492
[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl]-piperidin-1-ylmethanone;1-fluoro-4-methylbenzene (PubChem CID 143583492) has the molecular formula C31H37F7N2O2 and a molecular weight of 602.64 g/mol. Its IUPAC name is [2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl]-piperidin-1-ylmethanone;1-fluoro-4-methylbenzene.
| Compound Name | [2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl]-piperidin-1-ylmethanone;1-fluoro-4-methylbenzene |
|---|---|
| PubChem CID | 143583492 |
| Molecular Formula | C31H37F7N2O2 |
| Molecular Weight | 602.64 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | [2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl]-piperidin-1-ylmethanone;1-fluoro-4-methylbenzene |
| SMILES | CC1C(OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)CN2CCC(C(=O)N3CCCCC3)CC12.Cc1ccc(F)cc1 |
| InChI | InChI=1S/C24H30F6N2O2.C7H7F/c1-15-20-11-17(22(33)31-6-3-2-4-7-31)5-8-32(20)13-21(15)34-14-16-9-18(23(25,26)27)12-19(10-16)24(28,29)30;1-6-2-4-7(8)5-3-6/h9-10,12,15,17,20-21H,2-8,11,13-14H2,1H3;2-5H,1H3 |
| InChIKey | QUNMIYFXBPQQDD-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.64 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |