C19H20FN2O2+ — CID 143583526
(E)-1-[3-(4-fluorophenyl)pyrrolidin-1-yl]-3-(1-hydroxypyridin-1-ium-4-yl)but-2-en-1-one (PubChem CID 143583526) has the molecular formula C19H20FN2O2+ and a molecular weight of 327.38 g/mol. Its IUPAC name is (E)-1-[3-(4-fluorophenyl)pyrrolidin-1-yl]-3-(1-hydroxypyridin-1-ium-4-yl)but-2-en-1-one.
| Compound Name | (E)-1-[3-(4-fluorophenyl)pyrrolidin-1-yl]-3-(1-hydroxypyridin-1-ium-4-yl)but-2-en-1-one |
|---|---|
| PubChem CID | 143583526 |
| Molecular Formula | C19H20FN2O2+ |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | (E)-1-[3-(4-fluorophenyl)pyrrolidin-1-yl]-3-(1-hydroxypyridin-1-ium-4-yl)but-2-en-1-one |
| SMILES | C/C(=C\C(=O)N1CCC(c2ccc(F)cc2)C1)c1cc[n+](O)cc1 |
| InChI | InChI=1S/C19H20FN2O2/c1-14(15-7-10-22(24)11-8-15)12-19(23)21-9-6-17(13-21)16-2-4-18(20)5-3-16/h2-5,7-8,10-12,17,24H,6,9,13H2,1H3/q+1/b14-12+ |
| InChIKey | RSMAQXDKUZTGQJ-WYMLVPIESA-N |
| XLogP | 2.77 |
| TPSA | 44.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|