C19H24ClN5O3 — CID 143584154
(2E)-N-[4-[(2S)-2-aminopropoxy]-3-(4-chloro-1-methylpyrazol-5-yl)phenyl]-2-prop-1-en-2-yloxyiminopropanamide (PubChem CID 143584154) has the molecular formula C19H24ClN5O3 and a molecular weight of 405.89 g/mol. Its IUPAC name is (2E)-N-[4-[(2S)-2-aminopropoxy]-3-(4-chloro-1-methylpyrazol-5-yl)phenyl]-2-prop-1-en-2-yloxyiminopropanamide.
| Compound Name | (2E)-N-[4-[(2S)-2-aminopropoxy]-3-(4-chloro-1-methylpyrazol-5-yl)phenyl]-2-prop-1-en-2-yloxyiminopropanamide |
|---|---|
| PubChem CID | 143584154 |
| Molecular Formula | C19H24ClN5O3 |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | (2E)-N-[4-[(2S)-2-aminopropoxy]-3-(4-chloro-1-methylpyrazol-5-yl)phenyl]-2-prop-1-en-2-yloxyiminopropanamide |
| SMILES | C=C(C)O/N=C(\C)C(=O)Nc1ccc(OC[C@H](C)N)c(-c2c(Cl)cnn2C)c1 |
| InChI | InChI=1S/C19H24ClN5O3/c1-11(2)28-24-13(4)19(26)23-14-6-7-17(27-10-12(3)21)15(8-14)18-16(20)9-22-25(18)5/h6-9,12H,1,10,21H2,2-5H3,(H,23,26)/b24-13+/t12-/m0/s1 |
| InChIKey | PRLADVDBCACTTC-XNNJXTGESA-N |
| XLogP | 3.33 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|