C8H16N2 — CID 143584286
(Z)-2-ethylimino-N-methylpent-3-en-1-amine (PubChem CID 143584286) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is (Z)-2-ethylimino-N-methylpent-3-en-1-amine.
| Compound Name | (Z)-2-ethylimino-N-methylpent-3-en-1-amine |
|---|---|
| PubChem CID | 143584286 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | (Z)-2-ethylimino-N-methylpent-3-en-1-amine |
| SMILES | C/C=C\C(CNC)=N\CC |
| InChI | InChI=1S/C8H16N2/c1-4-6-8(7-9-3)10-5-2/h4,6,9H,5,7H2,1-3H3/b6-4-,10-8- |
| InChIKey | OFATVWIQHUELKW-GKXDXITGSA-N |
| XLogP | 1.24 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|