About S-methyl 3-[[2-ethoxyethyl(methyl)amino]methyl]naphthalene-2-carbothioate
S-methyl 3-[[2-ethoxyethyl(methyl)amino]methyl]naphthalene-2-carbothioate (PubChem CID 143584341) has the molecular formula C18H23NO2S
and a molecular weight of 317.45 g/mol. Its IUPAC name is S-methyl 3-[[2-ethoxyethyl(methyl)amino]methyl]naphthalene-2-carbothioate.
Molecular Properties
| Compound Name | S-methyl 3-[[2-ethoxyethyl(methyl)amino]methyl]naphthalene-2-carbothioate |
| PubChem CID | 143584341 |
| Molecular Formula | C18H23NO2S |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | S-methyl 3-[[2-ethoxyethyl(methyl)amino]methyl]naphthalene-2-carbothioate |
| SMILES | CCOCCN(C)Cc1cc2ccccc2cc1C(=O)SC |
| InChI | InChI=1S/C18H23NO2S/c1-4-21-10-9-19(2)13-16-11-14-7-5-6-8-15(14)12-17(16)18(20)22-3/h5-8,11-12H,4,9-10,13H2,1-3H3 |
| InChIKey | BMJBNHBLHARLNA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-methyl 3-[[2-ethoxyethyl(methyl)amino]methyl]naphthalene-2-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-methyl 3-[[2-ethoxyethyl(methyl)amino]methyl]naphthalene-2-carbothioate?
The IUPAC name of S-methyl 3-[[2-ethoxyethyl(methyl)amino]methyl]naphthalene-2-carbothioate (CID 143584341) is S-methyl 3-[[2-ethoxyethyl(methyl)amino]methyl]naphthalene-2-carbothioate.
What is the SMILES notation for S-methyl 3-[[2-ethoxyethyl(methyl)amino]methyl]naphthalene-2-carbothioate?
The canonical SMILES for S-methyl 3-[[2-ethoxyethyl(methyl)amino]methyl]naphthalene-2-carbothioate is CCOCCN(C)Cc1cc2ccccc2cc1C(=O)SC.
What is the InChIKey of S-methyl 3-[[2-ethoxyethyl(methyl)amino]methyl]naphthalene-2-carbothioate?
The InChIKey is BMJBNHBLHARLNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO2S/c1-4-21-10-9-19(2)13-16-11-14-7-5-6-8-15(14)12-17(16)18(20)22-3/h5-8,11-12H,4,9-10,13H2,1-3H3.
What are the key properties of S-methyl 3-[[2-ethoxyethyl(methyl)amino]methyl]naphthalene-2-carbothioate?
S-methyl 3-[[2-ethoxyethyl(methyl)amino]methyl]naphthalene-2-carbothioate has a molecular weight of 317.45 g/mol, XLogP of 3.81, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-methyl 3-[[2-ethoxyethyl(methyl)amino]methyl]naphthalene-2-carbothioate is sourced from PubChem (CID 143584341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).