C13H13N5O — CID 143585169
1,1,3-tri(pyrrol-1-yl)urea (PubChem CID 143585169) has the molecular formula C13H13N5O and a molecular weight of 255.28 g/mol. Its IUPAC name is 1,1,3-tri(pyrrol-1-yl)urea.
| Compound Name | 1,1,3-tri(pyrrol-1-yl)urea |
|---|---|
| PubChem CID | 143585169 |
| Molecular Formula | C13H13N5O |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 1,1,3-tri(pyrrol-1-yl)urea |
| SMILES | O=C(Nn1cccc1)N(n1cccc1)n1cccc1 |
| InChI | InChI=1S/C13H13N5O/c19-13(14-15-7-1-2-8-15)18(16-9-3-4-10-16)17-11-5-6-12-17/h1-12H,(H,14,19) |
| InChIKey | APFMEFLNBMYMSM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 47.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |