C25H28FN5O2 — CID 143585549
2-fluoro-N-[4-[5-[3-[(1S,4R,7S)-7-methyl-2-azabicyclo[2.2.1]heptan-2-yl]propylamino]-1,3,4-oxadiazol-2-yl]phenyl]benzamide (PubChem CID 143585549) has the molecular formula C25H28FN5O2 and a molecular weight of 449.53 g/mol. Its IUPAC name is 2-fluoro-N-[4-[5-[3-[(1S,4R,7S)-7-methyl-2-azabicyclo[2.2.1]heptan-2-yl]propylamino]-1,3,4-oxadiazol-2-yl]phenyl]benzamide.
| Compound Name | 2-fluoro-N-[4-[5-[3-[(1S,4R,7S)-7-methyl-2-azabicyclo[2.2.1]heptan-2-yl]propylamino]-1,3,4-oxadiazol-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 143585549 |
| Molecular Formula | C25H28FN5O2 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 2-fluoro-N-[4-[5-[3-[(1S,4R,7S)-7-methyl-2-azabicyclo[2.2.1]heptan-2-yl]propylamino]-1,3,4-oxadiazol-2-yl]phenyl]benzamide |
| SMILES | C[C@H]1[C@H]2CC[C@@H]1N(CCCNc1nnc(-c3ccc(NC(=O)c4ccccc4F)cc3)o1)C2 |
| InChI | InChI=1S/C25H28FN5O2/c1-16-18-9-12-22(16)31(15-18)14-4-13-27-25-30-29-24(33-25)17-7-10-19(11-8-17)28-23(32)20-5-2-3-6-21(20)26/h2-3,5-8,10-11,16,18,22H,4,9,12-15H2,1H3,(H,27,30)(H,28,32)/t16-,18-,22-/m0/s1 |
| InChIKey | LVFDNEYORJTZBJ-ZJBJCVSYSA-N |
| XLogP | 4.66 |
| TPSA | 83.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|