C26H33N3O — CID 143585741
ethylbenzene;N-hexan-3-yl-3-(pyridin-4-ylamino)benzamide (PubChem CID 143585741) has the molecular formula C26H33N3O and a molecular weight of 403.57 g/mol. Its IUPAC name is ethylbenzene;N-hexan-3-yl-3-(pyridin-4-ylamino)benzamide.
| Compound Name | ethylbenzene;N-hexan-3-yl-3-(pyridin-4-ylamino)benzamide |
|---|---|
| PubChem CID | 143585741 |
| Molecular Formula | C26H33N3O |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | ethylbenzene;N-hexan-3-yl-3-(pyridin-4-ylamino)benzamide |
| SMILES | CCCC(CC)NC(=O)c1cccc(Nc2ccncc2)c1.CCc1ccccc1 |
| InChI | InChI=1S/C18H23N3O.C8H10/c1-3-6-15(4-2)21-18(22)14-7-5-8-17(13-14)20-16-9-11-19-12-10-16;1-2-8-6-4-3-5-7-8/h5,7-13,15H,3-4,6H2,1-2H3,(H,19,20)(H,21,22);3-7H,2H2,1H3 |
| InChIKey | WRAFCAZVANNOKQ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |