C18H17ClN6 — CID 143585984
6-[(1R)-1-(6-chloro-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)ethyl]quinoline;ethanimine (PubChem CID 143585984) has the molecular formula C18H17ClN6 and a molecular weight of 352.83 g/mol. Its IUPAC name is 6-[(1R)-1-(6-chloro-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)ethyl]quinoline;ethanimine.
| Compound Name | 6-[(1R)-1-(6-chloro-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)ethyl]quinoline;ethanimine |
|---|---|
| PubChem CID | 143585984 |
| Molecular Formula | C18H17ClN6 |
| Molecular Weight | 352.83 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 6-[(1R)-1-(6-chloro-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)ethyl]quinoline;ethanimine |
| SMILES | C[C@H](c1ccc2ncccc2c1)c1nnc2ccc(Cl)nn12.[H]/N=C/C |
| InChI | InChI=1S/C16H12ClN5.C2H5N/c1-10(11-4-5-13-12(9-11)3-2-8-18-13)16-20-19-15-7-6-14(17)21-22(15)16;1-2-3/h2-10H,1H3;2-3H,1H3/b;3-2+/t10-;/m1./s1 |
| InChIKey | DLUJDNQQPOLYIJ-QBTPXYNDSA-N |
| XLogP | 4.13 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.83 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|